C27H37NOSi — CID 59714965
3-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexyl]propanenitrile (PubChem CID 59714965) has the molecular formula C27H37NOSi and a molecular weight of 419.69 g/mol. Its IUPAC name is 3-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexyl]propanenitrile.
| Compound Name | 3-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexyl]propanenitrile |
|---|---|
| PubChem CID | 59714965 |
| Molecular Formula | C27H37NOSi |
| Molecular Weight | 419.69 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 3-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexyl]propanenitrile |
| SMILES | CC(C)(C)[Si](OCCC1(CCC#N)CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H37NOSi/c1-26(2,3)30(24-14-7-4-8-15-24,25-16-9-5-10-17-25)29-23-21-27(20-13-22-28)18-11-6-12-19-27/h4-5,7-10,14-17H,6,11-13,18-21,23H2,1-3H3 |
| InChIKey | ZKKMOUHSSUGXIJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.69 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|