C33H53NO7SSi — CID 175063070
[tert-butyl-[2-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethoxy]ethyl]amino] propanoate (PubChem CID 175063070) has the molecular formula C33H53NO7SSi and a molecular weight of 635.94 g/mol. Its IUPAC name is [tert-butyl-[2-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethoxy]ethyl]amino] propanoate.
| Compound Name | [tert-butyl-[2-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethoxy]ethyl]amino] propanoate |
|---|---|
| PubChem CID | 175063070 |
| Molecular Formula | C33H53NO7SSi |
| Molecular Weight | 635.94 g/mol |
| Exact Mass | 635.33 |
| IUPAC Name | [tert-butyl-[2-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethoxy]ethyl]amino] propanoate |
| SMILES | CCC(=O)ON(CCOCCS(=O)(=O)OCC(C)(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C33H53NO7SSi/c1-10-30(35)41-34(31(2,3)4)22-24-38-25-26-42(36,37)39-27-33(8,9)21-23-40-43(32(5,6)7,28-17-13-11-14-18-28)29-19-15-12-16-20-29/h11-20H,10,21-27H2,1-9H3 |
| InChIKey | VHHVZHZHXAIKJB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.94 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|