C48H64N2O8SSi — CID 176584163
propan-2-yl 2-[(3S,5S)-5-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethoxymethyl]-3-(dibenzylamino)-2-oxopyrrolidin-1-yl]acetate (PubChem CID 176584163) has the molecular formula C48H64N2O8SSi and a molecular weight of 857.20 g/mol. Its IUPAC name is propan-2-yl 2-[(3S,5S)-5-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethoxymethyl]-3-(dibenzylamino)-2-oxopyrrolidin-1-yl]acetate.
| Compound Name | propan-2-yl 2-[(3S,5S)-5-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethoxymethyl]-3-(dibenzylamino)-2-oxopyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 176584163 |
| Molecular Formula | C48H64N2O8SSi |
| Molecular Weight | 857.20 g/mol |
| Exact Mass | 856.42 |
| IUPAC Name | propan-2-yl 2-[(3S,5S)-5-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethoxymethyl]-3-(dibenzylamino)-2-oxopyrrolidin-1-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)[C@@H](N(Cc2ccccc2)Cc2ccccc2)C[C@H]1COCCS(=O)(=O)OCC(C)(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C48H64N2O8SSi/c1-38(2)58-45(51)35-50-41(32-44(46(50)52)49(33-39-20-12-8-13-21-39)34-40-22-14-9-15-23-40)36-55-30-31-59(53,54)56-37-48(6,7)28-29-57-60(47(3,4)5,42-24-16-10-17-25-42)43-26-18-11-19-27-43/h8-27,38,41,44H,28-37H2,1-7H3/t41-,44-/m0/s1 |
| InChIKey | NZWFFVHWYUANTH-XKKDUZJHSA-N |
| XLogP | 6.97 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.20 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|