C30H45NO4SiSn — CID 11061202
tert-butyl (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-3-(trimethylstannylmethyl)pyrrolidine-1-carboxylate (PubChem CID 11061202) has the molecular formula C30H45NO4SiSn and a molecular weight of 630.49 g/mol. Its IUPAC name is tert-butyl (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-3-(trimethylstannylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-3-(trimethylstannylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11061202 |
| Molecular Formula | C30H45NO4SiSn |
| Molecular Weight | 630.49 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | tert-butyl (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-3-(trimethylstannylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H](C[Sn](C)(C)C)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H36NO4Si.3CH3.Sn/c1-20-18-21(28(24(20)29)25(30)32-26(2,3)4)19-31-33(27(5,6)7,22-14-10-8-11-15-22)23-16-12-9-13-17-23;;;;/h8-17,20-21H,1,18-19H2,2-7H3;3*1H3;/t20-,21-;;;;/m0..../s1 |
| InChIKey | NENZZBBXCKYVDK-GOPWMECQSA-N |
| XLogP | 6.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|