C22H27Cl3O4Si — CID 70879739
2,2,2-trichloroethyl 2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]acetate (PubChem CID 70879739) has the molecular formula C22H27Cl3O4Si and a molecular weight of 489.90 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]acetate.
| Compound Name | 2,2,2-trichloroethyl 2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]acetate |
|---|---|
| PubChem CID | 70879739 |
| Molecular Formula | C22H27Cl3O4Si |
| Molecular Weight | 489.90 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]acetate |
| SMILES | CC(C)(C)[Si](OCCOCC(=O)OCC(Cl)(Cl)Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27Cl3O4Si/c1-21(2,3)30(18-10-6-4-7-11-18,19-12-8-5-9-13-19)29-15-14-27-16-20(26)28-17-22(23,24)25/h4-13H,14-17H2,1-3H3 |
| InChIKey | DWNCXEFCHGGXNI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.90 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|