C36H47Cl3O5Si — CID 143649602
2,2,2-trichloroethyl 2-[4-[4-[tert-butyl(diphenyl)silyl]oxy-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]oxy-2-phenylacetate (PubChem CID 143649602) has the molecular formula C36H47Cl3O5Si and a molecular weight of 694.21 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[4-[4-[tert-butyl(diphenyl)silyl]oxy-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]oxy-2-phenylacetate.
| Compound Name | 2,2,2-trichloroethyl 2-[4-[4-[tert-butyl(diphenyl)silyl]oxy-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]oxy-2-phenylacetate |
|---|---|
| PubChem CID | 143649602 |
| Molecular Formula | C36H47Cl3O5Si |
| Molecular Weight | 694.21 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[4-[4-[tert-butyl(diphenyl)silyl]oxy-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]oxy-2-phenylacetate |
| SMILES | CC(C)(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCCC(C)(C)OC(C(=O)OCC(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C36H47Cl3O5Si/c1-33(2,3)45(29-19-13-9-14-20-29,30-21-15-10-16-22-30)43-26-24-34(4,5)42-25-23-35(6,7)44-31(28-17-11-8-12-18-28)32(40)41-27-36(37,38)39/h8-22,31H,23-27H2,1-7H3 |
| InChIKey | JAEJZCSITGJPOW-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.21 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|