C15H22N2O6S — CID 174860826
3-[(2-morpholin-4-ylethylsulfonyloxymethylamino)methyl]benzoic acid (PubChem CID 174860826) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[(2-morpholin-4-ylethylsulfonyloxymethylamino)methyl]benzoic acid.
| Compound Name | 3-[(2-morpholin-4-ylethylsulfonyloxymethylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 174860826 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-[(2-morpholin-4-ylethylsulfonyloxymethylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCOS(=O)(=O)CCN2CCOCC2)c1 |
| InChI | InChI=1S/C15H22N2O6S/c18-15(19)14-3-1-2-13(10-14)11-16-12-23-24(20,21)9-6-17-4-7-22-8-5-17/h1-3,10,16H,4-9,11-12H2,(H,18,19) |
| InChIKey | NEOHRBVNRCCSJI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|