C19H20N2O4 — CID 122029654
3-[[3-(morpholine-4-carbonyl)anilino]methyl]benzoic acid (PubChem CID 122029654) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[[3-(morpholine-4-carbonyl)anilino]methyl]benzoic acid.
| Compound Name | 3-[[3-(morpholine-4-carbonyl)anilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122029654 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-[[3-(morpholine-4-carbonyl)anilino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNc2cccc(C(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C19H20N2O4/c22-18(21-7-9-25-10-8-21)15-4-2-6-17(12-15)20-13-14-3-1-5-16(11-14)19(23)24/h1-6,11-12,20H,7-10,13H2,(H,23,24) |
| InChIKey | BNOBWCBHJNAEOQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |