C19H32N2O3 — CID 145404555
ethane;N-[[3-(morpholine-4-carbonyl)phenyl]methyl]propanamide (PubChem CID 145404555) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is ethane;N-[[3-(morpholine-4-carbonyl)phenyl]methyl]propanamide.
| Compound Name | ethane;N-[[3-(morpholine-4-carbonyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 145404555 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | ethane;N-[[3-(morpholine-4-carbonyl)phenyl]methyl]propanamide |
| SMILES | CC.CC.CCC(=O)NCc1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H20N2O3.2C2H6/c1-2-14(18)16-11-12-4-3-5-13(10-12)15(19)17-6-8-20-9-7-17;2*1-2/h3-5,10H,2,6-9,11H2,1H3,(H,16,18);2*1-2H3 |
| InChIKey | FPKULODYHMVCPG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |