C14H22Cl2N2O3 — CID 17159786
4-[(2-morpholin-4-ylethylamino)methyl]benzoic acid;dihydrochloride (PubChem CID 17159786) has the molecular formula C14H22Cl2N2O3 and a molecular weight of 337.25 g/mol. Its IUPAC name is 4-[(2-morpholin-4-ylethylamino)methyl]benzoic acid;dihydrochloride.
| Compound Name | 4-[(2-morpholin-4-ylethylamino)methyl]benzoic acid;dihydrochloride |
|---|---|
| PubChem CID | 17159786 |
| Molecular Formula | C14H22Cl2N2O3 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-[(2-morpholin-4-ylethylamino)methyl]benzoic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)c1ccc(CNCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C14H20N2O3.2ClH/c17-14(18)13-3-1-12(2-4-13)11-15-5-6-16-7-9-19-10-8-16;;/h1-4,15H,5-11H2,(H,17,18);2*1H |
| InChIKey | MNEMLCDSIDHSJA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|