C15H22N2O5S — CID 90187479
4-[2-(2-morpholin-4-ylethylsulfamoyl)ethyl]benzoic acid (PubChem CID 90187479) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[2-(2-morpholin-4-ylethylsulfamoyl)ethyl]benzoic acid.
| Compound Name | 4-[2-(2-morpholin-4-ylethylsulfamoyl)ethyl]benzoic acid |
|---|---|
| PubChem CID | 90187479 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-[2-(2-morpholin-4-ylethylsulfamoyl)ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCS(=O)(=O)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C15H22N2O5S/c18-15(19)14-3-1-13(2-4-14)5-12-23(20,21)16-6-7-17-8-10-22-11-9-17/h1-4,16H,5-12H2,(H,18,19) |
| InChIKey | LUFIYAHXNPRTHO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |