C33H39NO4Si — CID 102197822
(4R)-3-[(3S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 102197822) has the molecular formula C33H39NO4Si and a molecular weight of 541.76 g/mol. Its IUPAC name is (4R)-3-[(3S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(3S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102197822 |
| Molecular Formula | C33H39NO4Si |
| Molecular Weight | 541.76 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | (4R)-3-[(3S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@](C)(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(=O)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C33H39NO4Si/c1-6-33(5,24-30(35)34-29(25-37-31(34)36)26-16-10-7-11-17-26)22-23-38-39(32(2,3)4,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h6-21,29H,1,22-25H2,2-5H3/t29-,33-/m0/s1 |
| InChIKey | WXQUBMVVOJQGLL-ZQAZVOLISA-N |
| XLogP | 6.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.76 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|