C35H37NO6Si — CID 174059847
3-[2-[4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethoxyphenyl]acetyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 174059847) has the molecular formula C35H37NO6Si and a molecular weight of 595.77 g/mol. Its IUPAC name is 3-[2-[4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethoxyphenyl]acetyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethoxyphenyl]acetyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 174059847 |
| Molecular Formula | C35H37NO6Si |
| Molecular Weight | 595.77 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | 3-[2-[4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethoxyphenyl]acetyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | COc1cc(CC(=O)N2C(=O)OCC2c2ccccc2)cc(OC)c1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H37NO6Si/c1-35(2,3)43(27-17-11-7-12-18-27,28-19-13-8-14-20-28)42-33-30(39-4)21-25(22-31(33)40-5)23-32(37)36-29(24-41-34(36)38)26-15-9-6-10-16-26/h6-22,29H,23-24H2,1-5H3 |
| InChIKey | GLIODYSAMHJTAM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.77 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|