C32H40O5Si — CID 162745436
(2S)-2-[4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethoxyphenyl]-2-cyclohexylacetic acid (PubChem CID 162745436) has the molecular formula C32H40O5Si and a molecular weight of 532.75 g/mol. Its IUPAC name is (2S)-2-[4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethoxyphenyl]-2-cyclohexylacetic acid.
| Compound Name | (2S)-2-[4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethoxyphenyl]-2-cyclohexylacetic acid |
|---|---|
| PubChem CID | 162745436 |
| Molecular Formula | C32H40O5Si |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (2S)-2-[4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethoxyphenyl]-2-cyclohexylacetic acid |
| SMILES | COc1cc([C@@H](C(=O)O)C2CCCCC2)cc(OC)c1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H40O5Si/c1-32(2,3)38(25-17-11-7-12-18-25,26-19-13-8-14-20-26)37-30-27(35-4)21-24(22-28(30)36-5)29(31(33)34)23-15-9-6-10-16-23/h7-8,11-14,17-23,29H,6,9-10,15-16H2,1-5H3,(H,33,34)/t29-/m0/s1 |
| InChIKey | LXUZRLPYZOHENZ-LJAQVGFWSA-N |
| XLogP | 6.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|