C32H39NO4Si — CID 101174120
(4S)-3-[(3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3,4-dimethylpentanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 101174120) has the molecular formula C32H39NO4Si and a molecular weight of 529.75 g/mol. Its IUPAC name is (4S)-3-[(3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3,4-dimethylpentanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3,4-dimethylpentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101174120 |
| Molecular Formula | C32H39NO4Si |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | (4S)-3-[(3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3,4-dimethylpentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CC(=O)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H39NO4Si/c1-24(21-30(34)33-29(23-36-31(33)35)26-15-9-6-10-16-26)25(2)22-37-38(32(3,4)5,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,24-25,29H,21-23H2,1-5H3/t24-,25-,29+/m0/s1 |
| InChIKey | JVYWEGAYXRDBBJ-IALVYGIMSA-N |
| XLogP | 5.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|