C26H32O3Si — CID 102171832
prop-2-enyl 2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]cycloprop-2-ene-1-carboxylate (PubChem CID 102171832) has the molecular formula C26H32O3Si and a molecular weight of 420.63 g/mol. Its IUPAC name is prop-2-enyl 2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]cycloprop-2-ene-1-carboxylate.
| Compound Name | prop-2-enyl 2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]cycloprop-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 102171832 |
| Molecular Formula | C26H32O3Si |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | prop-2-enyl 2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]cycloprop-2-ene-1-carboxylate |
| SMILES | C=CCOC(=O)C1C=C1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H32O3Si/c1-5-18-28-25(27)24-20-21(24)13-12-19-29-30(26(2,3)4,22-14-8-6-9-15-22)23-16-10-7-11-17-23/h5-11,14-17,20,24H,1,12-13,18-19H2,2-4H3 |
| InChIKey | ATVPMDHCKHICFX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|