C33H41N3O6Si — CID 139271626
3-[1-[4-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-nitrophenyl]piperidin-4-yl]-1,3-oxazinan-2-one (PubChem CID 139271626) has the molecular formula C33H41N3O6Si and a molecular weight of 603.79 g/mol. Its IUPAC name is 3-[1-[4-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-nitrophenyl]piperidin-4-yl]-1,3-oxazinan-2-one.
| Compound Name | 3-[1-[4-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-nitrophenyl]piperidin-4-yl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 139271626 |
| Molecular Formula | C33H41N3O6Si |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 3-[1-[4-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-nitrophenyl]piperidin-4-yl]-1,3-oxazinan-2-one |
| SMILES | CC(C)(C)[Si](OCCOc1ccc(N2CCC(N3CCCOC3=O)CC2)c([N+](=O)[O-])c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H41N3O6Si/c1-33(2,3)43(28-11-6-4-7-12-28,29-13-8-5-9-14-29)42-24-23-40-27-15-16-30(31(25-27)36(38)39)34-20-17-26(18-21-34)35-19-10-22-41-32(35)37/h4-9,11-16,25-26H,10,17-24H2,1-3H3 |
| InChIKey | YIVRVBZJOCKTCN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 94.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|