C17H23N3O4 — CID 71145347
1-[1-[4-(hydroxymethyl)-2-nitrophenyl]piperidin-4-yl]piperidin-2-one (PubChem CID 71145347) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-[1-[4-(hydroxymethyl)-2-nitrophenyl]piperidin-4-yl]piperidin-2-one.
| Compound Name | 1-[1-[4-(hydroxymethyl)-2-nitrophenyl]piperidin-4-yl]piperidin-2-one |
|---|---|
| PubChem CID | 71145347 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-[1-[4-(hydroxymethyl)-2-nitrophenyl]piperidin-4-yl]piperidin-2-one |
| SMILES | O=C1CCCCN1C1CCN(c2ccc(CO)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H23N3O4/c21-12-13-4-5-15(16(11-13)20(23)24)18-9-6-14(7-10-18)19-8-2-1-3-17(19)22/h4-5,11,14,21H,1-3,6-10,12H2 |
| InChIKey | XSBCOBRUPFHQDA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|