C17H21N3O6 — CID 71145373
methyl 3-nitro-4-[4-(2-oxo-1,3-oxazinan-3-yl)piperidin-1-yl]benzoate (PubChem CID 71145373) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is methyl 3-nitro-4-[4-(2-oxo-1,3-oxazinan-3-yl)piperidin-1-yl]benzoate.
| Compound Name | methyl 3-nitro-4-[4-(2-oxo-1,3-oxazinan-3-yl)piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 71145373 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | methyl 3-nitro-4-[4-(2-oxo-1,3-oxazinan-3-yl)piperidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCC(N3CCCOC3=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21N3O6/c1-25-16(21)12-3-4-14(15(11-12)20(23)24)18-8-5-13(6-9-18)19-7-2-10-26-17(19)22/h3-4,11,13H,2,5-10H2,1H3 |
| InChIKey | GXEGOSWOQFNNIN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|