C28H36O4Si — CID 11123461
cis-methyl (1S,2R)-2-[5-[tert-butyl(diphenyl)silyl]oxypent-1-en-2-yl]-5-oxocyclopentane-1-carboxylate (PubChem CID 11123461) has the molecular formula C28H36O4Si and a molecular weight of 464.68 g/mol. Its IUPAC name is cis-methyl (1S,2R)-2-[5-[tert-butyl(diphenyl)silyl]oxypent-1-en-2-yl]-5-oxocyclopentane-1-carboxylate.
| Compound Name | cis-methyl (1S,2R)-2-[5-[tert-butyl(diphenyl)silyl]oxypent-1-en-2-yl]-5-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11123461 |
| Molecular Formula | C28H36O4Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | cis-methyl (1S,2R)-2-[5-[tert-butyl(diphenyl)silyl]oxypent-1-en-2-yl]-5-oxocyclopentane-1-carboxylate |
| SMILES | C=C(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1CCC(=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C28H36O4Si/c1-21(24-18-19-25(29)26(24)27(30)31-5)13-12-20-32-33(28(2,3)4,22-14-8-6-9-15-22)23-16-10-7-11-17-23/h6-11,14-17,24,26H,1,12-13,18-20H2,2-5H3/t24-,26-/m0/s1 |
| InChIKey | VSCKHVGGHMVORG-AHWVRZQESA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|