C30H40O4Si — CID 10973043
trans-ethyl (1R,2S)-2-[5-[tert-butyl(diphenyl)silyl]oxypent-1-en-2-yl]-1-methyl-5-oxocyclopentane-1-carboxylate (PubChem CID 10973043) has the molecular formula C30H40O4Si and a molecular weight of 492.73 g/mol. Its IUPAC name is trans-ethyl (1R,2S)-2-[5-[tert-butyl(diphenyl)silyl]oxypent-1-en-2-yl]-1-methyl-5-oxocyclopentane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2S)-2-[5-[tert-butyl(diphenyl)silyl]oxypent-1-en-2-yl]-1-methyl-5-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10973043 |
| Molecular Formula | C30H40O4Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | trans-ethyl (1R,2S)-2-[5-[tert-butyl(diphenyl)silyl]oxypent-1-en-2-yl]-1-methyl-5-oxocyclopentane-1-carboxylate |
| SMILES | C=C(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1CCC(=O)[C@]1(C)C(=O)OCC |
| InChI | InChI=1S/C30H40O4Si/c1-7-33-28(32)30(6)26(20-21-27(30)31)23(2)15-14-22-34-35(29(3,4)5,24-16-10-8-11-17-24)25-18-12-9-13-19-25/h8-13,16-19,26H,2,7,14-15,20-22H2,1,3-6H3/t26-,30+/m0/s1 |
| InChIKey | YKRYXDQYEZWIDM-FREGXXQWSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|