C38H49NO4Si — CID 10722436
ethyl (1R,4aR,4bR,8R,8aS,10aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-8a-cyano-1,4a-dimethyl-7-methylidene-2-oxo-4,4b,5,6,8,9,10,10a-octahydro-3H-phenanthrene-1-carboxylate (PubChem CID 10722436) has the molecular formula C38H49NO4Si and a molecular weight of 611.90 g/mol. Its IUPAC name is ethyl (1R,4aR,4bR,8R,8aS,10aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-8a-cyano-1,4a-dimethyl-7-methylidene-2-oxo-4,4b,5,6,8,9,10,10a-octahydro-3H-phenanthrene-1-carboxylate.
| Compound Name | ethyl (1R,4aR,4bR,8R,8aS,10aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-8a-cyano-1,4a-dimethyl-7-methylidene-2-oxo-4,4b,5,6,8,9,10,10a-octahydro-3H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 10722436 |
| Molecular Formula | C38H49NO4Si |
| Molecular Weight | 611.90 g/mol |
| Exact Mass | 611.34 |
| IUPAC Name | ethyl (1R,4aR,4bR,8R,8aS,10aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-8a-cyano-1,4a-dimethyl-7-methylidene-2-oxo-4,4b,5,6,8,9,10,10a-octahydro-3H-phenanthrene-1-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@@]3(C)CCC(=O)[C@](C)(C(=O)OCC)[C@@H]3CC[C@@]2(C#N)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H49NO4Si/c1-8-42-34(41)37(7)31-21-24-38(26-39)30(27(2)19-20-32(38)36(31,6)23-22-33(37)40)25-43-44(35(3,4)5,28-15-11-9-12-16-28)29-17-13-10-14-18-29/h9-18,30-32H,2,8,19-25H2,1,3-7H3/t30-,31-,32-,36+,37-,38-/m1/s1 |
| InChIKey | DPSYZLIDOZRMFB-CCCMRDRISA-N |
| XLogP | 7.00 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.90 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|