C33H46N2O3Si — CID 11027998
ethyl 4-[(4S,5S,7R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azaspiro[4.5]decan-7-yl]-2-cyanobutanoate (PubChem CID 11027998) has the molecular formula C33H46N2O3Si and a molecular weight of 546.83 g/mol. Its IUPAC name is ethyl 4-[(4S,5S,7R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azaspiro[4.5]decan-7-yl]-2-cyanobutanoate.
| Compound Name | ethyl 4-[(4S,5S,7R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azaspiro[4.5]decan-7-yl]-2-cyanobutanoate |
|---|---|
| PubChem CID | 11027998 |
| Molecular Formula | C33H46N2O3Si |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | ethyl 4-[(4S,5S,7R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azaspiro[4.5]decan-7-yl]-2-cyanobutanoate |
| SMILES | CCOC(=O)C(C#N)CC[C@H]1CCC[C@]2(CCC[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1 |
| InChI | InChI=1S/C33H46N2O3Si/c1-5-37-31(36)26(24-34)20-21-28-15-13-23-33(35-28)22-12-14-27(33)25-38-39(32(2,3)4,29-16-8-6-9-17-29)30-18-10-7-11-19-30/h6-11,16-19,26-28,35H,5,12-15,20-23,25H2,1-4H3/t26?,27-,28-,33+/m1/s1 |
| InChIKey | XVYHQRHKDSEKSN-MHOPPHRDSA-N |
| XLogP | 5.73 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|