C23H29NO3Si — CID 11718177
ethyl 3-[tert-butyl(diphenyl)silyl]oxy-4-cyanobutanoate (PubChem CID 11718177) has the molecular formula C23H29NO3Si and a molecular weight of 395.58 g/mol. Its IUPAC name is ethyl 3-[tert-butyl(diphenyl)silyl]oxy-4-cyanobutanoate.
| Compound Name | ethyl 3-[tert-butyl(diphenyl)silyl]oxy-4-cyanobutanoate |
|---|---|
| PubChem CID | 11718177 |
| Molecular Formula | C23H29NO3Si |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | ethyl 3-[tert-butyl(diphenyl)silyl]oxy-4-cyanobutanoate |
| SMILES | CCOC(=O)CC(CC#N)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H29NO3Si/c1-5-26-22(25)18-19(16-17-24)27-28(23(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19H,5,16,18H2,1-4H3 |
| InChIKey | LCYUEHZHBUPJIK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|