C37H51NO3Si — CID 11456044
tert-butyl-[2-[(4R,5S,7R)-4-[(2R)-1-(4-methoxyphenoxy)propan-2-yl]-6-azaspiro[4.5]decan-7-yl]ethoxy]-diphenylsilane (PubChem CID 11456044) has the molecular formula C37H51NO3Si and a molecular weight of 585.91 g/mol. Its IUPAC name is tert-butyl-[2-[(4R,5S,7R)-4-[(2R)-1-(4-methoxyphenoxy)propan-2-yl]-6-azaspiro[4.5]decan-7-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(4R,5S,7R)-4-[(2R)-1-(4-methoxyphenoxy)propan-2-yl]-6-azaspiro[4.5]decan-7-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11456044 |
| Molecular Formula | C37H51NO3Si |
| Molecular Weight | 585.91 g/mol |
| Exact Mass | 585.36 |
| IUPAC Name | tert-butyl-[2-[(4R,5S,7R)-4-[(2R)-1-(4-methoxyphenoxy)propan-2-yl]-6-azaspiro[4.5]decan-7-yl]ethoxy]-diphenylsilane |
| SMILES | COc1ccc(OC[C@H](C)[C@H]2CCC[C@]23CCC[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N3)cc1 |
| InChI | InChI=1S/C37H51NO3Si/c1-29(28-40-32-22-20-31(39-5)21-23-32)35-19-13-26-37(35)25-12-14-30(38-37)24-27-41-42(36(2,3)4,33-15-8-6-9-16-33)34-17-10-7-11-18-34/h6-11,15-18,20-23,29-30,35,38H,12-14,19,24-28H2,1-5H3/t29-,30+,35+,37+/m0/s1 |
| InChIKey | RTAKGIQASKDXCG-KXTVRRJYSA-N |
| XLogP | 7.36 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.91 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|