C30H42O2Si — CID 10322138
(1R,4R,7aR)-1-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-7a-methyl-1,2,4,5,6,7-hexahydroinden-4-ol (PubChem CID 10322138) has the molecular formula C30H42O2Si and a molecular weight of 462.75 g/mol. Its IUPAC name is (1R,4R,7aR)-1-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-7a-methyl-1,2,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (1R,4R,7aR)-1-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-7a-methyl-1,2,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 10322138 |
| Molecular Formula | C30H42O2Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (1R,4R,7aR)-1-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-7a-methyl-1,2,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CC=C2[C@H](O)CCC[C@@]21C |
| InChI | InChI=1S/C30H42O2Si/c1-23(26-18-19-27-28(31)17-12-21-30(26,27)5)20-22-32-33(29(2,3)4,24-13-8-6-9-14-24)25-15-10-7-11-16-25/h6-11,13-16,19,23,26,28,31H,12,17-18,20-22H2,1-5H3/t23-,26-,28-,30-/m1/s1 |
| InChIKey | ZDNWKLFSOGHPGB-TZLOCFMESA-N |
| XLogP | 6.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|