C37H50O2Si — CID 10370431
[(3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butoxy]-tert-butyl-diphenylsilane (PubChem CID 10370431) has the molecular formula C37H50O2Si and a molecular weight of 554.89 g/mol. Its IUPAC name is [(3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10370431 |
| Molecular Formula | C37H50O2Si |
| Molecular Weight | 554.89 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | [(3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CC[C@H]2[C@@H](OCc3ccccc3)CCC[C@]12C |
| InChI | InChI=1S/C37H50O2Si/c1-29(33-23-24-34-35(22-15-26-37(33,34)5)38-28-30-16-9-6-10-17-30)25-27-39-40(36(2,3)4,31-18-11-7-12-19-31)32-20-13-8-14-21-32/h6-14,16-21,29,33-35H,15,22-28H2,1-5H3/t29-,33-,34+,35+,37-/m1/s1 |
| InChIKey | XKBXMSWGGRSQAE-UZEUDAEASA-N |
| XLogP | 8.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.89 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|