C21H30O2 — CID 11141565
(3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butanal (PubChem CID 11141565) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butanal.
| Compound Name | (3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butanal |
|---|---|
| PubChem CID | 11141565 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butanal |
| SMILES | C[C@H](CC=O)[C@H]1CC[C@H]2[C@@H](OCc3ccccc3)CCC[C@]12C |
| InChI | InChI=1S/C21H30O2/c1-16(12-14-22)18-10-11-19-20(9-6-13-21(18,19)2)23-15-17-7-4-3-5-8-17/h3-5,7-8,14,16,18-20H,6,9-13,15H2,1-2H3/t16-,18-,19+,20+,21-/m1/s1 |
| InChIKey | NBJPCVFNTDYOIG-BVJIBDCISA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|