C24H36O3 — CID 70991637
[(3aR,4S,7aR)-1-[(2S,6S)-6-hydroxyheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate (PubChem CID 70991637) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is [(3aR,4S,7aR)-1-[(2S,6S)-6-hydroxyheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate.
| Compound Name | [(3aR,4S,7aR)-1-[(2S,6S)-6-hydroxyheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate |
|---|---|
| PubChem CID | 70991637 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | [(3aR,4S,7aR)-1-[(2S,6S)-6-hydroxyheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate |
| SMILES | C[C@H](O)CCC[C@H](C)C1CC[C@H]2[C@@H](OC(=O)c3ccccc3)CCC[C@]12C |
| InChI | InChI=1S/C24H36O3/c1-17(9-7-10-18(2)25)20-14-15-21-22(13-8-16-24(20,21)3)27-23(26)19-11-5-4-6-12-19/h4-6,11-12,17-18,20-22,25H,7-10,13-16H2,1-3H3/t17-,18-,20?,21-,22-,24+/m0/s1 |
| InChIKey | TWUXUAHTOFFUTE-BJMLFJMPSA-N |
| XLogP | 5.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |