C25H38O4 — CID 10692501
[(1R,3aR,4S,7aR)-1-[(2S,3R)-3,6-dihydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate (PubChem CID 10692501) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2S,3R)-3,6-dihydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2S,3R)-3,6-dihydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate |
|---|---|
| PubChem CID | 10692501 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2S,3R)-3,6-dihydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate |
| SMILES | C[C@H]([C@H](O)CCC(C)(C)O)[C@H]1CC[C@H]2[C@@H](OC(=O)c3ccccc3)CCC[C@]12C |
| InChI | InChI=1S/C25H38O4/c1-17(21(26)14-16-24(2,3)28)19-12-13-20-22(11-8-15-25(19,20)4)29-23(27)18-9-6-5-7-10-18/h5-7,9-10,17,19-22,26,28H,8,11-16H2,1-4H3/t17-,19+,20-,21+,22-,25+/m0/s1 |
| InChIKey | ZMKLDFKEDNBTAR-QYDHBBJVSA-N |
| XLogP | 4.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |