C24H38O3S — CID 102001193
(6R)-6-[(3aR,7aR)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylheptan-2-ol (PubChem CID 102001193) has the molecular formula C24H38O3S and a molecular weight of 406.63 g/mol. Its IUPAC name is (6R)-6-[(3aR,7aR)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(3aR,7aR)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 102001193 |
| Molecular Formula | C24H38O3S |
| Molecular Weight | 406.63 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (6R)-6-[(3aR,7aR)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylheptan-2-ol |
| SMILES | C[C@H](CCCC(C)(C)O)C1CC[C@H]2C(S(=O)(=O)c3ccccc3)CCC[C@]12C |
| InChI | InChI=1S/C24H38O3S/c1-18(10-8-16-23(2,3)25)20-14-15-21-22(13-9-17-24(20,21)4)28(26,27)19-11-6-5-7-12-19/h5-7,11-12,18,20-22,25H,8-10,13-17H2,1-4H3/t18-,20?,21+,22?,24-/m1/s1 |
| InChIKey | BPAUXHZXCUJBOX-IRWCFWBRSA-N |
| XLogP | 5.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |