C26H44O3 — CID 177492789
(1R,3S)-5-[(E)-2-[(1R,3aR,4S,7aS)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]ethenyl]cyclohex-4-ene-1,3-diol (PubChem CID 177492789) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is (1R,3S)-5-[(E)-2-[(1R,3aR,4S,7aS)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]ethenyl]cyclohex-4-ene-1,3-diol.
| Compound Name | (1R,3S)-5-[(E)-2-[(1R,3aR,4S,7aS)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]ethenyl]cyclohex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 177492789 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | (1R,3S)-5-[(E)-2-[(1R,3aR,4S,7aS)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]ethenyl]cyclohex-4-ene-1,3-diol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]2[C@H](/C=C/C3=C[C@@H](O)C[C@H](O)C3)CCC[C@@]12C |
| InChI | InChI=1S/C26H44O3/c1-18(7-5-13-25(2,3)29)23-11-12-24-20(8-6-14-26(23,24)4)10-9-19-15-21(27)17-22(28)16-19/h9-10,15,18,20-24,27-29H,5-8,11-14,16-17H2,1-4H3/b10-9+/t18-,20+,21-,22-,23-,24-,26+/m1/s1 |
| InChIKey | APQCJVLGEBBWCF-SWXZZTRKSA-N |
| XLogP | 5.39 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |