C24H39NO2 — CID 155527450
3-[[(1R,3aR,4S,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]amino]phenol (PubChem CID 155527450) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is 3-[[(1R,3aR,4S,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]amino]phenol.
| Compound Name | 3-[[(1R,3aR,4S,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]amino]phenol |
|---|---|
| PubChem CID | 155527450 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | 3-[[(1R,3aR,4S,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]amino]phenol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H](Nc3cccc(O)c3)CCC[C@]12C |
| InChI | InChI=1S/C24H39NO2/c1-17(8-6-14-23(2,3)27)20-12-13-21-22(11-7-15-24(20,21)4)25-18-9-5-10-19(26)16-18/h5,9-10,16-17,20-22,25-27H,6-8,11-15H2,1-4H3/t17-,20-,21+,22+,24-/m1/s1 |
| InChIKey | NMSKZEJRQYQJER-GOBSUPISSA-N |
| XLogP | 5.97 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |