C23H42O3 — CID 11035948
(3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methyl-6-(oxan-2-yloxy)heptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 11035948) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is (3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methyl-6-(oxan-2-yloxy)heptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methyl-6-(oxan-2-yloxy)heptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 11035948 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | (3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methyl-6-(oxan-2-yloxy)heptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C[C@H](CCCC(C)(C)OC1CCCCO1)C1CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C23H42O3/c1-17(18-12-13-19-20(24)10-8-15-23(18,19)4)9-7-14-22(2,3)26-21-11-5-6-16-25-21/h17-21,24H,5-16H2,1-4H3/t17-,18?,19+,20+,21?,23-/m1/s1 |
| InChIKey | GWTLWGKXASBNFH-OQOSEQOMSA-N |
| XLogP | 5.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |