C19H28F6O2 — CID 57056329
(1R,3aS,4R,7aS)-7a-methyl-1-[8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)oct-5-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 57056329) has the molecular formula C19H28F6O2 and a molecular weight of 402.42 g/mol. Its IUPAC name is (1R,3aS,4R,7aS)-7a-methyl-1-[8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)oct-5-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aS,4R,7aS)-7a-methyl-1-[8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)oct-5-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 57056329 |
| Molecular Formula | C19H28F6O2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (1R,3aS,4R,7aS)-7a-methyl-1-[8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)oct-5-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(CCC=CC(O)(C(F)(F)F)C(F)(F)F)[C@H]1CC[C@@H]2[C@H](O)CCC[C@@]12C |
| InChI | InChI=1S/C19H28F6O2/c1-12(13-8-9-14-15(26)7-5-10-16(13,14)2)6-3-4-11-17(27,18(20,21)22)19(23,24)25/h4,11-15,26-27H,3,5-10H2,1-2H3/t12?,13-,14-,15-,16+/m1/s1 |
| InChIKey | HHTUXVYJGHOEQB-ZOSGLXAKSA-N |
| XLogP | 5.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|