C28H50F6O3 — CID 143298703
(1R)-7a-methyl-1-[(Z,6S)-1,1,1-trifluoro-2-hydroxy-6,10,10-trimethyl-2-(trifluoromethyl)undec-3-en-6-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol;ethane;methanol (PubChem CID 143298703) has the molecular formula C28H50F6O3 and a molecular weight of 548.69 g/mol. Its IUPAC name is (1R)-7a-methyl-1-[(Z,6S)-1,1,1-trifluoro-2-hydroxy-6,10,10-trimethyl-2-(trifluoromethyl)undec-3-en-6-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol;ethane;methanol.
| Compound Name | (1R)-7a-methyl-1-[(Z,6S)-1,1,1-trifluoro-2-hydroxy-6,10,10-trimethyl-2-(trifluoromethyl)undec-3-en-6-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol;ethane;methanol |
|---|---|
| PubChem CID | 143298703 |
| Molecular Formula | C28H50F6O3 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | (1R)-7a-methyl-1-[(Z,6S)-1,1,1-trifluoro-2-hydroxy-6,10,10-trimethyl-2-(trifluoromethyl)undec-3-en-6-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol;ethane;methanol |
| SMILES | CC.CC(C)(C)CCC[C@@](C)(C/C=C\C(O)(C(F)(F)F)C(F)(F)F)[C@H]1CCC2C(O)CCCC21C.CO |
| InChI | InChI=1S/C25H40F6O2.C2H6.CH4O/c1-20(2,3)12-7-13-21(4,14-8-16-23(33,24(26,27)28)25(29,30)31)19-11-10-17-18(32)9-6-15-22(17,19)5;2*1-2/h8,16-19,32-33H,6-7,9-15H2,1-5H3;1-2H3;2H,1H3/b16-8-;;/t17?,18?,19-,21+,22?;;/m1../s1 |
| InChIKey | IVYHFZYZYRPBBR-TYWOTRGHSA-N |
| XLogP | 8.22 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|