C22H40O — CID 143647439
(1R,4S,7aR)-1-[(E,5R)-5,9-dimethyldec-2-en-5-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 143647439) has the molecular formula C22H40O and a molecular weight of 320.56 g/mol. Its IUPAC name is (1R,4S,7aR)-1-[(E,5R)-5,9-dimethyldec-2-en-5-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,4S,7aR)-1-[(E,5R)-5,9-dimethyldec-2-en-5-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 143647439 |
| Molecular Formula | C22H40O |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | (1R,4S,7aR)-1-[(E,5R)-5,9-dimethyldec-2-en-5-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C/C=C/C[C@@](C)(CCCC(C)C)[C@H]1CCC2[C@@H](O)CCC[C@@]21C |
| InChI | InChI=1S/C22H40O/c1-6-7-14-21(4,15-8-10-17(2)3)20-13-12-18-19(23)11-9-16-22(18,20)5/h6-7,17-20,23H,8-16H2,1-5H3/b7-6+/t18?,19-,20+,21-,22-/m0/s1 |
| InChIKey | GSSFELPTVUGMFJ-HVFTYYAASA-N |
| XLogP | 6.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|