C24H44O — CID 143647537
(1R,7aR)-1-[(E,5R)-5,9-dimethyldec-2-en-5-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane (PubChem CID 143647537) has the molecular formula C24H44O and a molecular weight of 348.62 g/mol. Its IUPAC name is (1R,7aR)-1-[(E,5R)-5,9-dimethyldec-2-en-5-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane.
| Compound Name | (1R,7aR)-1-[(E,5R)-5,9-dimethyldec-2-en-5-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane |
|---|---|
| PubChem CID | 143647537 |
| Molecular Formula | C24H44O |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.34 |
| IUPAC Name | (1R,7aR)-1-[(E,5R)-5,9-dimethyldec-2-en-5-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane |
| SMILES | C/C=C/C[C@@](C)(CCCC(C)C)[C@H]1CCC2C(=O)CCC[C@@]21C.CC |
| InChI | InChI=1S/C22H38O.C2H6/c1-6-7-14-21(4,15-8-10-17(2)3)20-13-12-18-19(23)11-9-16-22(18,20)5;1-2/h6-7,17-18,20H,8-16H2,1-5H3;1-2H3/b7-6+;/t18?,20-,21+,22+;/m1./s1 |
| InChIKey | WGZWWOPLQLRTRP-KQWSRCJVSA-N |
| XLogP | 7.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|