C26H50O3 — CID 143298765
(1R)-1-(2,10-dihydroxy-2,6,10-trimethylundecan-6-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane (PubChem CID 143298765) has the molecular formula C26H50O3 and a molecular weight of 410.68 g/mol. Its IUPAC name is (1R)-1-(2,10-dihydroxy-2,6,10-trimethylundecan-6-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane.
| Compound Name | (1R)-1-(2,10-dihydroxy-2,6,10-trimethylundecan-6-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane |
|---|---|
| PubChem CID | 143298765 |
| Molecular Formula | C26H50O3 |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 410.38 |
| IUPAC Name | (1R)-1-(2,10-dihydroxy-2,6,10-trimethylundecan-6-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane |
| SMILES | CC.CC(C)(O)CCCC(C)(CCCC(C)(C)O)[C@H]1CCC2C(=O)CCCC21C |
| InChI | InChI=1S/C24H44O3.C2H6/c1-21(2,26)13-8-15-23(5,16-9-14-22(3,4)27)20-12-11-18-19(25)10-7-17-24(18,20)6;1-2/h18,20,26-27H,7-17H2,1-6H3;1-2H3/t18?,20-,24?;/m1./s1 |
| InChIKey | NMOXAXMAXRTVEO-WWGHOZHUSA-N |
| XLogP | 6.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |