C23H40O4 — CID 71051330
(1R,7aR)-1-[(6S)-2,10-dihydroxy-2,10-dimethyl-3-oxoundecan-6-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 71051330) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is (1R,7aR)-1-[(6S)-2,10-dihydroxy-2,10-dimethyl-3-oxoundecan-6-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,7aR)-1-[(6S)-2,10-dihydroxy-2,10-dimethyl-3-oxoundecan-6-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 71051330 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (1R,7aR)-1-[(6S)-2,10-dihydroxy-2,10-dimethyl-3-oxoundecan-6-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(C)(O)CCC[C@@H](CCC(=O)C(C)(C)O)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C23H40O4/c1-21(2,26)14-6-8-16(10-13-20(25)22(3,4)27)17-11-12-18-19(24)9-7-15-23(17,18)5/h16-18,26-27H,6-15H2,1-5H3/t16-,17+,18?,23+/m0/s1 |
| InChIKey | CJVOPZYWVYWPDK-MAMDQWKRSA-N |
| XLogP | 4.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |