C23H44O — CID 142996252
(7aR)-1-[(2S)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane;ethene (PubChem CID 142996252) has the molecular formula C23H44O and a molecular weight of 336.60 g/mol. Its IUPAC name is (7aR)-1-[(2S)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane;ethene.
| Compound Name | (7aR)-1-[(2S)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane;ethene |
|---|---|
| PubChem CID | 142996252 |
| Molecular Formula | C23H44O |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 336.34 |
| IUPAC Name | (7aR)-1-[(2S)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane;ethene |
| SMILES | C=C.CC.C[C@@H](CCCC(C)(C)C)C1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C19H34O.C2H6.C2H4/c1-14(8-6-12-18(2,3)4)15-10-11-16-17(20)9-7-13-19(15,16)5;2*1-2/h14-16H,6-13H2,1-5H3;1-2H3;1-2H2/t14-,15?,16?,19+;;/m0../s1 |
| InChIKey | RFFKFLKKXQYATK-IMYUIPQASA-N |
| XLogP | 7.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|