C21H36F4O2Si — CID 174105723
(1R,3aR,7aR)-1-[6-(difluoromethyl)-7,7-difluoro-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 174105723) has the molecular formula C21H36F4O2Si and a molecular weight of 424.60 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-[6-(difluoromethyl)-7,7-difluoro-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-1-[6-(difluoromethyl)-7,7-difluoro-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 174105723 |
| Molecular Formula | C21H36F4O2Si |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (1R,3aR,7aR)-1-[6-(difluoromethyl)-7,7-difluoro-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(CCCC(O[Si](C)(C)C)(C(F)F)C(F)F)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C21H36F4O2Si/c1-14(15-10-11-16-17(26)9-7-12-20(15,16)2)8-6-13-21(18(22)23,19(24)25)27-28(3,4)5/h14-16,18-19H,6-13H2,1-5H3/t14?,15-,16+,20-/m1/s1 |
| InChIKey | ZANYOIGNTCAWNF-CIUFUOKISA-N |
| XLogP | 6.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|