C25H42F4O3Si — CID 174105777
ethyl (2E)-2-[(1R,3aS,7aR)-1-[6-(difluoromethyl)-7,7-difluoro-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]acetate (PubChem CID 174105777) has the molecular formula C25H42F4O3Si and a molecular weight of 494.69 g/mol. Its IUPAC name is ethyl (2E)-2-[(1R,3aS,7aR)-1-[6-(difluoromethyl)-7,7-difluoro-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(1R,3aS,7aR)-1-[6-(difluoromethyl)-7,7-difluoro-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]acetate |
|---|---|
| PubChem CID | 174105777 |
| Molecular Formula | C25H42F4O3Si |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | ethyl (2E)-2-[(1R,3aS,7aR)-1-[6-(difluoromethyl)-7,7-difluoro-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CCC[C@]2(C)[C@@H](C(C)CCCC(O[Si](C)(C)C)(C(F)F)C(F)F)CC[C@@H]12 |
| InChI | InChI=1S/C25H42F4O3Si/c1-7-31-21(30)16-18-11-9-14-24(3)19(12-13-20(18)24)17(2)10-8-15-25(22(26)27,23(28)29)32-33(4,5)6/h16-17,19-20,22-23H,7-15H2,1-6H3/b18-16+/t17?,19-,20+,24-/m1/s1 |
| InChIKey | HSHHQAPWMXSWGI-AFHOJAIVSA-N |
| XLogP | 7.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|