C32H54O3Si — CID 57276709
[(1S)-3-[2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] acetate (PubChem CID 57276709) has the molecular formula C32H54O3Si and a molecular weight of 514.87 g/mol. Its IUPAC name is [(1S)-3-[2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] acetate.
| Compound Name | [(1S)-3-[2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] acetate |
|---|---|
| PubChem CID | 57276709 |
| Molecular Formula | C32H54O3Si |
| Molecular Weight | 514.87 g/mol |
| Exact Mass | 514.38 |
| IUPAC Name | [(1S)-3-[2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] acetate |
| SMILES | C=C1CC[C@H](OC(C)=O)CC1=CC=C1CCC[C@]2(C)[C@@H]([C@H](C)CCCC(C)(C)O[Si](C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C32H54O3Si/c1-23-14-17-28(34-25(3)33)22-27(23)16-15-26-13-11-21-32(6)29(18-19-30(26)32)24(2)12-10-20-31(4,5)35-36(7,8)9/h15-16,24,28-30H,1,10-14,17-22H2,2-9H3/t24-,28+,29-,30+,32-/m1/s1 |
| InChIKey | DFEMSHKGVIUDDH-YAFFSAAPSA-N |
| XLogP | 9.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.87 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|