C29H47NO4 — CID 123688159
[(1S)-3-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] aminomethyl carbonate (PubChem CID 123688159) has the molecular formula C29H47NO4 and a molecular weight of 473.70 g/mol. Its IUPAC name is [(1S)-3-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] aminomethyl carbonate.
| Compound Name | [(1S)-3-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] aminomethyl carbonate |
|---|---|
| PubChem CID | 123688159 |
| Molecular Formula | C29H47NO4 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | [(1S)-3-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] aminomethyl carbonate |
| SMILES | C=C1CC[C@H](OC(=O)OCN)CC1=CC=C1CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C29H47NO4/c1-20-10-13-24(34-27(31)33-19-30)18-23(20)12-11-22-9-7-17-29(5)25(14-15-26(22)29)21(2)8-6-16-28(3,4)32/h11-12,21,24-26,32H,1,6-10,13-19,30H2,2-5H3/t21-,24+,25-,26?,29-/m1/s1 |
| InChIKey | VGICXCHIAGZHAA-GFHWYULBSA-N |
| XLogP | 6.81 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|