C29H48O2S — CID 91084169
(6R)-6-[(1R,7aR)-7a-methyl-4-[2-[(5S)-2-methylidene-5-(methylsulfanylmethoxy)cyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol (PubChem CID 91084169) has the molecular formula C29H48O2S and a molecular weight of 460.77 g/mol. Its IUPAC name is (6R)-6-[(1R,7aR)-7a-methyl-4-[2-[(5S)-2-methylidene-5-(methylsulfanylmethoxy)cyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,7aR)-7a-methyl-4-[2-[(5S)-2-methylidene-5-(methylsulfanylmethoxy)cyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 91084169 |
| Molecular Formula | C29H48O2S |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | (6R)-6-[(1R,7aR)-7a-methyl-4-[2-[(5S)-2-methylidene-5-(methylsulfanylmethoxy)cyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
| SMILES | C=C1CC[C@H](OCSC)CC1=CC=C1CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C29H48O2S/c1-21-11-14-25(31-20-32-6)19-24(21)13-12-23-10-8-18-29(5)26(15-16-27(23)29)22(2)9-7-17-28(3,4)30/h12-13,22,25-27,30H,1,7-11,14-20H2,2-6H3/t22-,25+,26-,27?,29-/m1/s1 |
| InChIKey | SOPNOLSDJDRZAU-LZCCVUOLSA-N |
| XLogP | 8.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|