C28H45BrO2 — CID 90931554
(6R)-6-[(1R,7aR)-4-[2-[(5S)-5-(bromomethoxy)-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol (PubChem CID 90931554) has the molecular formula C28H45BrO2 and a molecular weight of 493.57 g/mol. Its IUPAC name is (6R)-6-[(1R,7aR)-4-[2-[(5S)-5-(bromomethoxy)-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,7aR)-4-[2-[(5S)-5-(bromomethoxy)-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 90931554 |
| Molecular Formula | C28H45BrO2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | (6R)-6-[(1R,7aR)-4-[2-[(5S)-5-(bromomethoxy)-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
| SMILES | C=C1CC[C@H](OCBr)CC1=CC=C1CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C28H45BrO2/c1-20-10-13-24(31-19-29)18-23(20)12-11-22-9-7-17-28(5)25(14-15-26(22)28)21(2)8-6-16-27(3,4)30/h11-12,21,24-26,30H,1,6-10,13-19H2,2-5H3/t21-,24+,25-,26?,28-/m1/s1 |
| InChIKey | AIGCOLLDMHSKPI-SYOOKJLNSA-N |
| XLogP | 8.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|