C30H47BrO2 — CID 59361078
[(1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate (PubChem CID 59361078) has the molecular formula C30H47BrO2 and a molecular weight of 519.61 g/mol. Its IUPAC name is [(1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate.
| Compound Name | [(1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate |
|---|---|
| PubChem CID | 59361078 |
| Molecular Formula | C30H47BrO2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | [(1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate |
| SMILES | C=C1CC[C@H](OC(=O)CBr)C/C1=C/C=C1\CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)CCCC(C)(C)C |
| InChI | InChI=1S/C30H47BrO2/c1-21-11-14-25(33-28(32)20-31)19-24(21)13-12-23-10-8-18-30(6)26(15-16-27(23)30)22(2)9-7-17-29(3,4)5/h12-13,22,25-27H,1,7-11,14-20H2,2-6H3/b23-12+,24-13-/t22-,25+,26-,27?,30-/m1/s1 |
| InChIKey | NLPRQJGFSIYLNF-PHAMPMEKSA-N |
| XLogP | 8.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|