C29H43BrO4 — CID 11852081
[(1S,3Z)-3-[(2E)-2-[(1R)-1-[(2S)-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate (PubChem CID 11852081) has the molecular formula C29H43BrO4 and a molecular weight of 535.56 g/mol. Its IUPAC name is [(1S,3Z)-3-[(2E)-2-[(1R)-1-[(2S)-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate.
| Compound Name | [(1S,3Z)-3-[(2E)-2-[(1R)-1-[(2S)-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate |
|---|---|
| PubChem CID | 11852081 |
| Molecular Formula | C29H43BrO4 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | [(1S,3Z)-3-[(2E)-2-[(1R)-1-[(2S)-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate |
| SMILES | C=C1CC[C@H](OC(=O)CBr)C/C1=C/C=C1\CCCC2(C)C1CC[C@@H]2[C@@H](C)CCC(=O)C(C)(C)O |
| InChI | InChI=1S/C29H43BrO4/c1-19-8-12-23(34-27(32)18-30)17-22(19)11-10-21-7-6-16-29(5)24(13-14-25(21)29)20(2)9-15-26(31)28(3,4)33/h10-11,20,23-25,33H,1,6-9,12-18H2,2-5H3/b21-10+,22-11-/t20-,23-,24+,25?,29?/m0/s1 |
| InChIKey | AQQMGGAUMJNEML-NFCFCRAGSA-N |
| XLogP | 6.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|