C29H39BrF6O3 — CID 73126767
[3-[2-[7a-methyl-1-[7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate (PubChem CID 73126767) has the molecular formula C29H39BrF6O3 and a molecular weight of 629.52 g/mol. Its IUPAC name is [3-[2-[7a-methyl-1-[7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate.
| Compound Name | [3-[2-[7a-methyl-1-[7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate |
|---|---|
| PubChem CID | 73126767 |
| Molecular Formula | C29H39BrF6O3 |
| Molecular Weight | 629.52 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | [3-[2-[7a-methyl-1-[7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 2-bromoacetate |
| SMILES | C=C1CCC(OC(=O)CBr)CC1=CC=C1CCCC2(C)C1CCC2C(C)CCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H39BrF6O3/c1-18-8-11-22(39-25(37)17-30)16-21(18)10-9-20-7-5-14-26(3)23(12-13-24(20)26)19(2)6-4-15-27(38,28(31,32)33)29(34,35)36/h9-10,19,22-24,38H,1,4-8,11-17H2,2-3H3 |
| InChIKey | QXAYBNSWCYMGMT-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.52 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|